Difference between revisions of "TRNA-Sec"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Retinols == * common-name: ** a retinol == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound == *...") |
(Created page with "Category:metabolite == Metabolite CPD-14604 == * common-name: ** mycophenolic acid phenolic glucuronide * molecular-weight: ** 494.451 * inchi-key: ** byfgtsayqqiucn-hgihd...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-14604 == |
* common-name: | * common-name: | ||
− | ** | + | ** mycophenolic acid phenolic glucuronide |
+ | * molecular-weight: | ||
+ | ** 494.451 | ||
+ | * inchi-key: | ||
+ | ** byfgtsayqqiucn-hgihdbqlsa-l | ||
+ | * smiles: | ||
+ | ** cc(ccc([o-])=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))2)3))oc) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-13608]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=mycophenolic acid phenolic glucuronide}} |
+ | {{#set: molecular-weight=494.451}} | ||
+ | {{#set: inchi-key=inchikey=byfgtsayqqiucn-hgihdbqlsa-l}} |
Revision as of 17:54, 13 January 2021
Contents
Metabolite CPD-14604
- common-name:
- mycophenolic acid phenolic glucuronide
- molecular-weight:
- 494.451
- inchi-key:
- byfgtsayqqiucn-hgihdbqlsa-l
- smiles:
- cc(ccc([o-])=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))2)3))oc)