Difference between revisions of "VAL-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-HYDROXY-FERULIC-ACID == * common-name: ** 5-hydroxyferulate * molecular-weight: ** 209.178 * inchi-key: ** yfxwtvldsksylw-nscuhmnnsa-m...")
 
(Created page with "Category:metabolite == Metabolite CPD-17387 == * common-name: ** (3s,6z,9z,12z,15z,18z,21z)-3-hydroxytetracosahexaenoyl-coa * molecular-weight: ** 1118.034 * inchi-key: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-HYDROXY-FERULIC-ACID ==
+
== Metabolite CPD-17387 ==
 
* common-name:
 
* common-name:
** 5-hydroxyferulate
+
** (3s,6z,9z,12z,15z,18z,21z)-3-hydroxytetracosahexaenoyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 209.178
+
** 1118.034
 
* inchi-key:
 
* inchi-key:
** yfxwtvldsksylw-nscuhmnnsa-m
+
** jjcguwrdulvwqg-drxnpijbsa-j
 
* smiles:
 
* smiles:
** coc1(c=c(c=cc([o-])=o)c=c(o)c(o)=1)
+
** ccc=ccc=ccc=ccc=ccc=ccc=cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-16136]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-1121]]
+
* [[RXN-16135]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-hydroxyferulate}}
+
{{#set: common-name=(3s,6z,9z,12z,15z,18z,21z)-3-hydroxytetracosahexaenoyl-coa}}
{{#set: molecular-weight=209.178}}
+
{{#set: molecular-weight=1118.034}}
{{#set: inchi-key=inchikey=yfxwtvldsksylw-nscuhmnnsa-m}}
+
{{#set: inchi-key=inchikey=jjcguwrdulvwqg-drxnpijbsa-j}}

Revision as of 17:52, 13 January 2021

Metabolite CPD-17387

  • common-name:
    • (3s,6z,9z,12z,15z,18z,21z)-3-hydroxytetracosahexaenoyl-coa
  • molecular-weight:
    • 1118.034
  • inchi-key:
    • jjcguwrdulvwqg-drxnpijbsa-j
  • smiles:
    • ccc=ccc=ccc=ccc=ccc=ccc=cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality