Difference between revisions of "VAL-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17387 == * common-name: ** (3s,6z,9z,12z,15z,18z,21z)-3-hydroxytetracosahexaenoyl-coa * molecular-weight: ** 1118.034 * inchi-key: **...")
(Created page with "Category:metabolite == Metabolite cis-delta21-3-hydroxyC40-ACPs == * common-name: ** a cis-delta21-3-hydroxyc40:1-[acp] == Reaction(s) known to consume the compound == ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17387 ==
+
== Metabolite cis-delta21-3-hydroxyC40-ACPs ==
 
* common-name:
 
* common-name:
** (3s,6z,9z,12z,15z,18z,21z)-3-hydroxytetracosahexaenoyl-coa
+
** a cis-delta21-3-hydroxyc40:1-[acp]
* molecular-weight:
 
** 1118.034
 
* inchi-key:
 
** jjcguwrdulvwqg-drxnpijbsa-j
 
* smiles:
 
** ccc=ccc=ccc=ccc=ccc=ccc=cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16136]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16135]]
+
* [[RXN1G-287]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3s,6z,9z,12z,15z,18z,21z)-3-hydroxytetracosahexaenoyl-coa}}
+
{{#set: common-name=a cis-delta21-3-hydroxyc40:1-[acp]}}
{{#set: molecular-weight=1118.034}}
 
{{#set: inchi-key=inchikey=jjcguwrdulvwqg-drxnpijbsa-j}}
 

Revision as of 15:07, 15 March 2021

Metabolite cis-delta21-3-hydroxyC40-ACPs

  • common-name:
    • a cis-delta21-3-hydroxyc40:1-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a cis-delta21-3-hydroxyc40:1-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.