Difference between revisions of "VAL-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17387 == * common-name: ** (3s,6z,9z,12z,15z,18z,21z)-3-hydroxytetracosahexaenoyl-coa * molecular-weight: ** 1118.034 * inchi-key: **...")
(Created page with "Category:metabolite == Metabolite VAL-tRNAs == * common-name: ** a trnaval == Reaction(s) known to consume the compound == * VALINE--TRNA-LIGASE-RXN == Reaction(s) kno...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-17387 ==
+
== Metabolite VAL-tRNAs ==
 
* common-name:
 
* common-name:
−
** (3s,6z,9z,12z,15z,18z,21z)-3-hydroxytetracosahexaenoyl-coa
+
** a trnaval
−
* molecular-weight:
 
−
** 1118.034
 
−
* inchi-key:
 
−
** jjcguwrdulvwqg-drxnpijbsa-j
 
−
* smiles:
 
−
** ccc=ccc=ccc=ccc=ccc=ccc=cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-16136]]
+
* [[VALINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-16135]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=(3s,6z,9z,12z,15z,18z,21z)-3-hydroxytetracosahexaenoyl-coa}}
+
{{#set: common-name=a trnaval}}
−
{{#set: molecular-weight=1118.034}}
 
−
{{#set: inchi-key=inchikey=jjcguwrdulvwqg-drxnpijbsa-j}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite VAL-tRNAs

  • common-name:
    • a trnaval

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=VAL-tRNAs&oldid=48948"