Difference between revisions of "DNA-Guanines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite OLEOYL-COA == * smiles: ** ccccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(...")
 
(Created page with "Category:metabolite == Metabolite DNA-Guanines == * common-name: ** a guanine in dna == Reaction(s) known to consume the compound == == Reaction(s) known to produce the co...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite OLEOYL-COA ==
+
== Metabolite DNA-Guanines ==
* smiles:
 
** ccccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
 
* common-name:
 
* common-name:
** oleoyl-coa
+
** a guanine in dna
* inchi-key:
 
** xduhqpoxluavee-bpmmelmssa-j
 
* molecular-weight:
 
** 1027.953
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15043]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9644]]
+
* [[2.1.1.63-RXN]]
* [[RXN0-7239]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=oleoyl-coa}}
+
{{#set: common-name=a guanine in dna}}
{{#set: inchi-key=inchikey=xduhqpoxluavee-bpmmelmssa-j}}
 
{{#set: molecular-weight=1027.953}}
 

Latest revision as of 17:43, 15 January 2021

Metabolite DNA-Guanines

  • common-name:
    • a guanine in dna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality