Difference between revisions of "B-ALANINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GDP-TP == * smiles: ** c(op([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])c1(oc(c(o)c(op([o-])(=o)op(o)([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) *...")
(Created page with "Category:metabolite == Metabolite B-ALANINE == * smiles: ** c(c[n+])c([o-])=o * common-name: ** β-alanine * inchi-key: ** ucmirnveixfbks-uhfffaoysa-n * molecular-weig...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GDP-TP ==
+
== Metabolite B-ALANINE ==
 
* smiles:
 
* smiles:
** c(op([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])c1(oc(c(o)c(op([o-])(=o)op(o)([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
+
** c(c[n+])c([o-])=o
 
* common-name:
 
* common-name:
** pppgpp
+
** β-alanine
 
* inchi-key:
 
* inchi-key:
** kcpmacxzaitqax-uuokfmhzsa-h
+
** ucmirnveixfbks-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 677.095
+
** 89.094
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PPPGPPHYDRO-RXN]]
+
* [[2.6.1.18-RXN]]
* [[RXN0-6427]]
+
* [[PANTOATE-BETA-ALANINE-LIG-RXN]]
 +
* [[RXN0-5201]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GTPPYPHOSKIN-RXN]]
+
* [[2.6.1.18-RXN]]
 +
* [[ASPDECARBOX-RXN]]
 +
* [[RXN0-5201]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pppgpp}}
+
{{#set: common-name=β-alanine}}
{{#set: inchi-key=inchikey=kcpmacxzaitqax-uuokfmhzsa-h}}
+
{{#set: inchi-key=inchikey=ucmirnveixfbks-uhfffaoysa-n}}
{{#set: molecular-weight=677.095}}
+
{{#set: molecular-weight=89.094}}

Latest revision as of 17:43, 15 January 2021

Metabolite B-ALANINE

  • smiles:
    • c(c[n+])c([o-])=o
  • common-name:
    • β-alanine
  • inchi-key:
    • ucmirnveixfbks-uhfffaoysa-n
  • molecular-weight:
    • 89.094

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality