Difference between revisions of "HYDROGEN-PEROXIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-HYDROXY-CTP == * smiles: ** c(c2(c(c(o)c(n1(c(n=c(c(o)=c1)n)=o))o2)o))op(op(op([o-])([o-])=o)([o-])=o)([o-])=o * common-name: ** 5-hydr...") |
(Created page with "Category:metabolite == Metabolite HYDROGEN-PEROXIDE == * smiles: ** oo * common-name: ** hydrogen peroxide * inchi-key: ** mhajpdpjqmaiiy-uhfffaoysa-n * molecular-weight:...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite HYDROGEN-PEROXIDE == |
* smiles: | * smiles: | ||
| − | ** | + | ** oo |
* common-name: | * common-name: | ||
| − | ** | + | ** hydrogen peroxide |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** mhajpdpjqmaiiy-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 34.015 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[GLUTATHIONE-PEROXIDASE-RXN]] |
| + | * [[NADH-PEROXIDASE-RXN]] | ||
| + | * [[RXN-17881]] | ||
| + | * [[RXN-17882]] | ||
| + | * [[RXN-17883]] | ||
| + | * [[RXN0-267]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[L-ASPARTATE-OXID-RXN]] | ||
| + | * [[PMPOXI-RXN]] | ||
| + | * [[PNPOXI-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=hydrogen peroxide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mhajpdpjqmaiiy-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=34.015}} |
Latest revision as of 17:43, 15 January 2021
Contents
Metabolite HYDROGEN-PEROXIDE
- smiles:
- oo
- common-name:
- hydrogen peroxide
- inchi-key:
- mhajpdpjqmaiiy-uhfffaoysa-n
- molecular-weight:
- 34.015
