Difference between revisions of "CPD-14424"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-3-4-Saturated-L-Phosphatidates == * common-name: ** a 1,2-diacyl-sn-glycerol 3-phosphate == Reaction(s) known to consume the compound =...")
 
(Created page with "Category:metabolite == Metabolite CPD-14424 == * smiles: ** ccc=ccc=ccc=ccc=ccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-3-4-Saturated-L-Phosphatidates ==
+
== Metabolite CPD-14424 ==
 +
* smiles:
 +
** ccc=ccc=ccc=ccc=ccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* common-name:
 
* common-name:
** a 1,2-diacyl-sn-glycerol 3-phosphate
+
** (5z,8z,11z,14z,17z)-3r-hydroxy-docosapentaenoyl-coa
 +
* inchi-key:
 +
** kidydclnvxonef-pybsmvoosa-j
 +
* molecular-weight:
 +
** 1091.996
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-5514]]
+
* [[RXN-13443]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 1,2-diacyl-sn-glycerol 3-phosphate}}
+
{{#set: common-name=(5z,8z,11z,14z,17z)-3r-hydroxy-docosapentaenoyl-coa}}
 +
{{#set: inchi-key=inchikey=kidydclnvxonef-pybsmvoosa-j}}
 +
{{#set: molecular-weight=1091.996}}

Latest revision as of 17:43, 15 January 2021

Metabolite CPD-14424

  • smiles:
    • ccc=ccc=ccc=ccc=ccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • common-name:
    • (5z,8z,11z,14z,17z)-3r-hydroxy-docosapentaenoyl-coa
  • inchi-key:
    • kidydclnvxonef-pybsmvoosa-j
  • molecular-weight:
    • 1091.996

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality