Difference between revisions of "CPD-622"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPDQT-37 == * smiles: ** csccccc(c(o)c(=o)[o-])c(=o)[o-] * common-name: ** 3-(4'-methylthio)butylmalate * inchi-key: ** zizldvklmyvmnx-uh...") |
(Created page with "Category:metabolite == Metabolite CPD-622 == * smiles: ** cc(c(=o)[o-])c(o)(cc(=o)[o-])c(=o)[o-] * common-name: ** (2s,3s)-2-methylcitrate * inchi-key: ** ynoxcrmfgmskij-n...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-622 == |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c(=o)[o-])c(o)(cc(=o)[o-])c(=o)[o-] |
* common-name: | * common-name: | ||
| − | ** | + | ** (2s,3s)-2-methylcitrate |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ynoxcrmfgmskij-nfncenrgsa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 203.128 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2-METHYLCITRATE-SYNTHASE-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[2-METHYLCITRATE-SYNTHASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(2s,3s)-2-methylcitrate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ynoxcrmfgmskij-nfncenrgsa-k}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=203.128}} |
Latest revision as of 17:43, 15 January 2021
Contents
Metabolite CPD-622
- smiles:
- cc(c(=o)[o-])c(o)(cc(=o)[o-])c(=o)[o-]
- common-name:
- (2s,3s)-2-methylcitrate
- inchi-key:
- ynoxcrmfgmskij-nfncenrgsa-k
- molecular-weight:
- 203.128
