Difference between revisions of "CPD-69"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ARACHIDONIC_ACID == * smiles: ** cccccc=ccc=ccc=ccc=ccccc(=o)[o-] * common-name: ** arachidonate * inchi-key: ** yzxbapsdxzzrgb-dofzraljs...") |
(Created page with "Category:metabolite == Metabolite CPD-69 == * smiles: ** c([o-])#n * common-name: ** cyanate * inchi-key: ** xljmaioerfsogz-uhfffaoysa-m * molecular-weight: ** 42.017 == R...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-69 == |
* smiles: | * smiles: | ||
− | ** | + | ** c([o-])#n |
* common-name: | * common-name: | ||
− | ** | + | ** cyanate |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** xljmaioerfsogz-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 42.017 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-17753]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=cyanate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xljmaioerfsogz-uhfffaoysa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=42.017}} |
Latest revision as of 17:43, 15 January 2021
Contents
Metabolite CPD-69
- smiles:
- c([o-])#n
- common-name:
- cyanate
- inchi-key:
- xljmaioerfsogz-uhfffaoysa-m
- molecular-weight:
- 42.017