Difference between revisions of "VAL-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite IMIDAZOLE-ACETOL-P == * smiles: ** c1(nc=nc=1cc(cop([o-])(=o)[o-])=o) * common-name: ** imidazole acetol-phosphate * inchi-key: ** ycffms...") |
(Created page with "Category:metabolite == Metabolite VAL-tRNAs == * common-name: ** a trnaval == Reaction(s) known to consume the compound == * VALINE--TRNA-LIGASE-RXN == Reaction(s) kno...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite VAL-tRNAs == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** a trnaval |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[VALINE--TRNA-LIGASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a trnaval}} |
| − | |||
| − | |||
Latest revision as of 17:43, 15 January 2021
Contents
Metabolite VAL-tRNAs
- common-name:
- a trnaval
