Difference between revisions of "DNA-Holder"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DEOXYXYLULOSE-5P == * smiles: ** cc(=o)c(o)c(o)cop([o-])(=o)[o-] * common-name: ** 1-deoxy-d-xylulose 5-phosphate * inchi-key: ** ajpadpz...") |
(Created page with "Category:metabolite == Metabolite DNA-Holder == * common-name: ** dna == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound == * 3...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DNA-Holder == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** dna |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[3.1.26.4-RXN]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dna}} |
| − | |||
| − | |||
Latest revision as of 17:43, 15 January 2021
Contents
Metabolite DNA-Holder
- common-name:
- dna
