Difference between revisions of "Protein-N5-alkylglutamines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2-OCTAPRENYL-6-HYDROXYPHENOL == * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c)c)c * common...") |
(Created page with "Category:metabolite == Metabolite Protein-N5-alkylglutamines == * common-name: ** a protein-n5-alkylglutamine == Reaction(s) known to consume the compound == * 2.3.2.13-...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Protein-N5-alkylglutamines == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** a protein-n5-alkylglutamine |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[2 | + | * [[2.3.2.13-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[2.3.2.13-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a protein-n5-alkylglutamine}} |
| − | |||
| − | |||
Latest revision as of 17:44, 15 January 2021
Contents
Metabolite Protein-N5-alkylglutamines
- common-name:
- a protein-n5-alkylglutamine
