Difference between revisions of "ASP-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite XTP == * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23))) * common-name: ** xtp * inchi...") |
(Created page with "Category:metabolite == Metabolite ASP-tRNAs == * common-name: ** trnaasp == Reaction(s) known to consume the compound == * ASPARTATE--TRNA-LIGASE-RXN == Reaction(s) kn...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ASP-tRNAs == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** trnaasp |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ASPARTATE--TRNA-LIGASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=trnaasp}} |
| − | |||
| − | |||
Latest revision as of 17:44, 15 January 2021
Contents
Metabolite ASP-tRNAs
- common-name:
- trnaasp
