Difference between revisions of "2-AMINOMALONATE-SEMIALDEHYDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PROTOPORPHYRINOGEN == * smiles: ** c=cc1(=c5(nc(=c1c)cc2(=c(c(=c(n2)cc3(nc(=c(c=3ccc([o-])=o)c)cc4(=c(c(=c(n4)c5)c)c=c)))ccc(=o)[o-])c)))...")
 
(Created page with "Category:metabolite == Metabolite 2-AMINOMALONATE-SEMIALDEHYDE == * smiles: ** [ch](=o)c([n+])c(=o)[o-] * common-name: ** 2-aminomalonate semialdehyde * inchi-key: ** xmtc...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PROTOPORPHYRINOGEN ==
+
== Metabolite 2-AMINOMALONATE-SEMIALDEHYDE ==
 
* smiles:
 
* smiles:
** c=cc1(=c5(nc(=c1c)cc2(=c(c(=c(n2)cc3(nc(=c(c=3ccc([o-])=o)c)cc4(=c(c(=c(n4)c5)c)c=c)))ccc(=o)[o-])c)))
+
** [ch](=o)c([n+])c(=o)[o-]
 
* common-name:
 
* common-name:
** protoporphyrinogen ix
+
** 2-aminomalonate semialdehyde
 
* inchi-key:
 
* inchi-key:
** uhsgpdmiqqynax-uhfffaoysa-l
+
** xmtcknxttxdpjx-reohclbhsa-n
 
* molecular-weight:
 
* molecular-weight:
** 566.699
+
** 103.077
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HEMN-RXN]]
+
* [[RXN0-2201]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=protoporphyrinogen ix}}
+
{{#set: common-name=2-aminomalonate semialdehyde}}
{{#set: inchi-key=inchikey=uhsgpdmiqqynax-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=xmtcknxttxdpjx-reohclbhsa-n}}
{{#set: molecular-weight=566.699}}
+
{{#set: molecular-weight=103.077}}

Latest revision as of 17:44, 15 January 2021

Metabolite 2-AMINOMALONATE-SEMIALDEHYDE

  • smiles:
    • [ch](=o)c([n+])c(=o)[o-]
  • common-name:
    • 2-aminomalonate semialdehyde
  • inchi-key:
    • xmtcknxttxdpjx-reohclbhsa-n
  • molecular-weight:
    • 103.077

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality