Difference between revisions of "GLT-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2121 == * smiles: ** cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3...")
(Created page with "Category:metabolite == Metabolite GLT-tRNAs == * common-name: ** a trnaglu == Reaction(s) known to consume the compound == * GLURS-RXN == Reaction(s) known to produce...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-2121 ==
+
== Metabolite GLT-tRNAs ==
* smiles:
 
** cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
 
* common-name:
 
* common-name:
** trans-hex-2-enoyl-coa
+
** a trnaglu
* inchi-key:
 
** oinxhibnzuuimr-ixuyqxaasa-j
 
* molecular-weight:
 
** 859.631
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[GLURS-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12567]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=trans-hex-2-enoyl-coa}}
+
{{#set: common-name=a trnaglu}}
{{#set: inchi-key=inchikey=oinxhibnzuuimr-ixuyqxaasa-j}}
 
{{#set: molecular-weight=859.631}}
 

Latest revision as of 17:44, 15 January 2021

Metabolite GLT-tRNAs

  • common-name:
    • a trnaglu

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality