Difference between revisions of "CPD-235"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-oxo-behenoyl-ACPs == * common-name: ** a 3-oxo-behenoyl-[acp] == Reaction(s) known to consume the compound == * RXN1G-157 * RXN1G...") |
(Created page with "Category:metabolite == Metabolite CPD-235 == * smiles: ** c(c(=o)c([o-])=o)p([o-])(o)=o * common-name: ** 3-phosphonopyruvate * inchi-key: ** chddavcoaofsld-uhfffaoysa-l *...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-235 == |
| + | * smiles: | ||
| + | ** c(c(=o)c([o-])=o)p([o-])(o)=o | ||
* common-name: | * common-name: | ||
| − | ** | + | ** 3-phosphonopyruvate |
| + | * inchi-key: | ||
| + | ** chddavcoaofsld-uhfffaoysa-l | ||
| + | * molecular-weight: | ||
| + | ** 166.027 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[PEPM]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[PEPM]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-phosphonopyruvate}} |
| + | {{#set: inchi-key=inchikey=chddavcoaofsld-uhfffaoysa-l}} | ||
| + | {{#set: molecular-weight=166.027}} | ||
Latest revision as of 17:44, 15 January 2021
Contents
Metabolite CPD-235
- smiles:
- c(c(=o)c([o-])=o)p([o-])(o)=o
- common-name:
- 3-phosphonopyruvate
- inchi-key:
- chddavcoaofsld-uhfffaoysa-l
- molecular-weight:
- 166.027
