Difference between revisions of "CPD-235"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17086 == * smiles: ** ccccccc=ccccccccc(occ(cop(occ[n+])([o-])=o)oc(=o)cccccccc=ccccccc)=o * common-name: ** 1-16:1-2-16:1-phosphatid...") |
(Created page with "Category:metabolite == Metabolite CPD-235 == * smiles: ** c(c(=o)c([o-])=o)p([o-])(o)=o * common-name: ** 3-phosphonopyruvate * inchi-key: ** chddavcoaofsld-uhfffaoysa-l *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-235 == |
* smiles: | * smiles: | ||
| − | ** | + | ** c(c(=o)c([o-])=o)p([o-])(o)=o |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-phosphonopyruvate |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** chddavcoaofsld-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 166.027 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[PEPM]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[PEPM]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-phosphonopyruvate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=chddavcoaofsld-uhfffaoysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=166.027}} |
Latest revision as of 17:44, 15 January 2021
Contents
Metabolite CPD-235
- smiles:
- c(c(=o)c([o-])=o)p([o-])(o)=o
- common-name:
- 3-phosphonopyruvate
- inchi-key:
- chddavcoaofsld-uhfffaoysa-l
- molecular-weight:
- 166.027
