Difference between revisions of "2-PG"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12819 == * smiles: ** cccccccccccccccc(=o)occ(oc(=o)ccccccccccccccc)cop(occ[n+])([o-])=o * common-name: ** 1,2-dipalmitoyl-phosphatid...") |
(Created page with "Category:metabolite == Metabolite 2-PG == * smiles: ** c(=o)([o-])c(op(=o)([o-])[o-])co * common-name: ** 2-phospho-d-glycerate * inchi-key: ** gxiurptvhjpjlf-uwtatzphsa-k...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 2-PG == |
* smiles: | * smiles: | ||
− | ** | + | ** c(=o)([o-])c(op(=o)([o-])[o-])co |
* common-name: | * common-name: | ||
− | ** | + | ** 2-phospho-d-glycerate |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** gxiurptvhjpjlf-uwtatzphsa-k |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 183.034 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2PGADEHYDRAT-RXN]] |
+ | * [[3PGAREARR-RXN]] | ||
+ | * [[RXN-15510]] | ||
+ | * [[RXN-15513]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[2PGADEHYDRAT-RXN]] |
− | * [[ | + | * [[3PGAREARR-RXN]] |
+ | * [[GKI-RXN]] | ||
+ | * [[RXN-15510]] | ||
+ | * [[RXN-15513]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=2-phospho-d-glycerate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=gxiurptvhjpjlf-uwtatzphsa-k}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=183.034}} |
Latest revision as of 17:44, 15 January 2021
Contents
Metabolite 2-PG
- smiles:
- c(=o)([o-])c(op(=o)([o-])[o-])co
- common-name:
- 2-phospho-d-glycerate
- inchi-key:
- gxiurptvhjpjlf-uwtatzphsa-k
- molecular-weight:
- 183.034