Difference between revisions of "CPD-8180"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite MANNOSE-1P == * smiles: ** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) * common-name: ** α-d-mannose 1-phosphate * inchi-key: ** hxxf...") |
(Created page with "Category:metabolite == Metabolite CPD-8180 == * common-name: ** dna with lesion == Reaction(s) known to consume the compound == * RXN0-2621 == Reaction(s) known to pro...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-8180 == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** dna with lesion |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-2621]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dna with lesion}} |
| − | |||
| − | |||
Latest revision as of 17:44, 15 January 2021
Contents
Metabolite CPD-8180
- common-name:
- dna with lesion
