Difference between revisions of "ALLANTOIN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDROFOLATE == * smiles: ** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c3(cnc2(=c(c(=o)nc(n)=n2)n=3)) * common-name: ** 7,8-dihydr...") |
(Created page with "Category:metabolite == Metabolite ALLANTOIN == * common-name: ** allantoin == Reaction(s) known to consume the compound == * ALLTN == Reaction(s) known to produce the...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ALLANTOIN == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** allantoin |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ALLTN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=allantoin}} |
| − | |||
| − | |||
Latest revision as of 17:45, 15 January 2021
Contents
Metabolite ALLANTOIN
- common-name:
- allantoin
