Difference between revisions of "MYO-INOSITOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-380 == * smiles: ** c(=o)([o-])c(=o)cs(=o)(=o)[o-] * common-name: ** 3-sulfopyruvate * inchi-key: ** buthmsuebypmkj-uhfffaoysa-l * mo...") |
(Created page with "Category:metabolite == Metabolite MYO-INOSITOL == * smiles: ** c1(c(c(c(c(c1o)o)o)o)o)o * common-name: ** myo-inositol * inchi-key: ** cdaismweouebre-gpivlxjgsa-n * molecu...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite MYO-INOSITOL == |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c1(c(c(c(c(c1o)o)o)o)o)o |
* common-name: | * common-name: | ||
| − | ** | + | ** myo-inositol |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** cdaismweouebre-gpivlxjgsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 180.157 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[3.1.4.44-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=myo-inositol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cdaismweouebre-gpivlxjgsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=180.157}} |
Latest revision as of 17:45, 15 January 2021
Contents
Metabolite MYO-INOSITOL
- smiles:
- c1(c(c(c(c(c1o)o)o)o)o)o
- common-name:
- myo-inositol
- inchi-key:
- cdaismweouebre-gpivlxjgsa-n
- molecular-weight:
- 180.157
