Difference between revisions of "HIS-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 4-P-PANTOTHENATE == * smiles: ** cc(c(c(=o)nccc(=o)[o-])o)(cop([o-])([o-])=o)c * common-name: ** (r)-4'-phosphopantothenate * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite HIS-tRNAs == * common-name: ** a trnahis == Reaction(s) known to consume the compound == * HISTIDINE--TRNA-LIGASE-RXN == Reaction(s)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite HIS-tRNAs == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** a trnahis |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[HISTIDINE--TRNA-LIGASE-RXN]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a trnahis}} |
| − | |||
| − | |||
Latest revision as of 17:45, 15 January 2021
Contents
Metabolite HIS-tRNAs
- common-name:
- a trnahis
