Difference between revisions of "MONOMER0-4342"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite MALTOTRIOSE == * smiles: ** c(c1(oc(c(c(c1o)o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co)))o * common-name: ** maltotriose * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite MONOMER0-4342 == == Reaction(s) known to consume the compound == * RXN-17362 == Reaction(s) known to produce the compound == * RXN0...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite MONOMER0-4342 == |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-17362]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN0-20]] | |
| − | * [[RXN0- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
| − | |||
