Difference between revisions of "Alpha-Amyloses"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9406 == * smiles: ** ccc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o...")
 
(Created page with "Category:metabolite == Metabolite Alpha-Amyloses == * common-name: ** α-amylose == Reaction(s) known to consume the compound == * RXN-14372 == Reaction(s) known...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9406 ==
+
== Metabolite Alpha-Amyloses ==
* smiles:
 
** ccc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c([o-])=o
 
 
* common-name:
 
* common-name:
** (2s)-ethylmalonyl-coa
+
** α-amylose
* inchi-key:
 
** vugzqvcbbbezqe-uqcjfraesa-i
 
* molecular-weight:
 
** 876.595
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14372]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8957]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2s)-ethylmalonyl-coa}}
+
{{#set: common-name=α-amylose}}
{{#set: inchi-key=inchikey=vugzqvcbbbezqe-uqcjfraesa-i}}
 
{{#set: molecular-weight=876.595}}
 

Latest revision as of 17:46, 15 January 2021

Metabolite Alpha-Amyloses

  • common-name:
    • α-amylose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality