Difference between revisions of "Orthology"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-CITRULLINE == * smiles: ** c(nc(n)=o)ccc([n+])c(=o)[o-] * common-name: ** l-citrulline * inchi-key: ** rhgklrlohdjjdr-bypyzucnsa-n * mo...")
 
(Created page with "{{#ask: Category:reaction reconstruction category::orthology | ?common-name | ?ec-number | ?reconstruction tool | ?reconstruction source | ?reconstruction comment | ?n...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
{{#ask: [[Category:reaction]] [[reconstruction category::orthology]]
== Metabolite L-CITRULLINE ==
+
| ?common-name
* smiles:
+
| ?ec-number
** c(nc(n)=o)ccc([n+])c(=o)[o-]
+
| ?reconstruction tool
* common-name:
+
| ?reconstruction source
** l-citrulline
+
| ?reconstruction comment
* inchi-key:
+
| ?nb gene associated
** rhgklrlohdjjdr-bypyzucnsa-n
+
| ?nb pathway associated
* molecular-weight:
+
}}
** 175.187
 
== Reaction(s) known to consume the compound ==
 
* [[ARGSUCCINSYN-RXN]]
 
* [[OCBT]]
 
* [[ORNCARBAMTRANSFER-RXN]]
 
== Reaction(s) known to produce the compound ==
 
* [[OCBT]]
 
* [[ORNCARBAMTRANSFER-RXN]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=l-citrulline}}
 
{{#set: inchi-key=inchikey=rhgklrlohdjjdr-bypyzucnsa-n}}
 
{{#set: molecular-weight=175.187}}
 

Latest revision as of 17:46, 15 January 2021