Difference between revisions of "DNA-Guanines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite OLEOYL-COA == * smiles: ** ccccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(...") |
(Created page with "Category:metabolite == Metabolite AMINO-HYDROXYMETHYL-METHYL-PYR-P == * smiles: ** cc1(n=cc(cop(=o)([o-])[o-])=c(n=1)n) * common-name: ** 4-amino-2-methyl-5-(phosphooxymet...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite AMINO-HYDROXYMETHYL-METHYL-PYR-P == |
* smiles: | * smiles: | ||
| − | ** | + | ** cc1(n=cc(cop(=o)([o-])[o-])=c(n=1)n) |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-amino-2-methyl-5-(phosphooxymethyl)pyrimidine |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** pkyfhkiyhbrtpi-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 217.121 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[PYRIMSYN3-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[OHMETPYRKIN-RXN]] |
| − | * [[RXN0- | + | * [[PYRIMSYN1-RXN]] |
| + | * [[RXN0-3543]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-amino-2-methyl-5-(phosphooxymethyl)pyrimidine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pkyfhkiyhbrtpi-uhfffaoysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=217.121}} |
Revision as of 18:45, 23 November 2020
Contents
Metabolite AMINO-HYDROXYMETHYL-METHYL-PYR-P
- smiles:
- cc1(n=cc(cop(=o)([o-])[o-])=c(n=1)n)
- common-name:
- 4-amino-2-methyl-5-(phosphooxymethyl)pyrimidine
- inchi-key:
- pkyfhkiyhbrtpi-uhfffaoysa-l
- molecular-weight:
- 217.121
