Difference between revisions of "HYDROGEN-PEROXIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-HYDROXY-CTP == * smiles: ** c(c2(c(c(o)c(n1(c(n=c(c(o)=c1)n)=o))o2)o))op(op(op([o-])([o-])=o)([o-])=o)([o-])=o * common-name: ** 5-hydr...") |
(Created page with "Category:metabolite == Metabolite R2-2OH-Straight-Chain-234-Sat-FA-CoA == * common-name: ** a (r)-2-hydroxy even numbered straight chain 2,3,4-saturated fatty acyl coa ==...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite R2-2OH-Straight-Chain-234-Sat-FA-CoA == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** a (r)-2-hydroxy even numbered straight chain 2,3,4-saturated fatty acyl coa |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN66-474]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a (r)-2-hydroxy even numbered straight chain 2,3,4-saturated fatty acyl coa}} |
| − | |||
| − | |||
Revision as of 18:45, 23 November 2020
Contents
Metabolite R2-2OH-Straight-Chain-234-Sat-FA-CoA
- common-name:
- a (r)-2-hydroxy even numbered straight chain 2,3,4-saturated fatty acyl coa
