Difference between revisions of "L-ARABINOSE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 8-AMINO-7-OXONONANOATE == * smiles: ** cc(c(cccccc([o-])=o)=o)[n+] * common-name: ** 8-amino-7-oxononanoate * inchi-key: ** guahpajoxvyfo...") |
(Created page with "Category:metabolite == Metabolite L-ARABINOSE == * common-name: ** l-arabinose == Reaction(s) known to consume the compound == * ABC-2-RXN == Reaction(s) known to prod...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite L-ARABINOSE == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** l-arabinose |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ABC-2-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ABC-2-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-arabinose}} |
| − | |||
| − | |||
Revision as of 18:45, 23 November 2020
Contents
Metabolite L-ARABINOSE
- common-name:
- l-arabinose
