Difference between revisions of "CPD-622"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SO3 == * smiles: ** [o-]s([o-])=o * common-name: ** sulfite * inchi-key: ** lsnnmfcwukxfee-uhfffaoysa-l * molecular-weight: ** 80.058 ==...")
 
(Created page with "Category:metabolite == Metabolite CPDQT-37 == * smiles: ** csccccc(c(o)c(=o)[o-])c(=o)[o-] * common-name: ** 3-(4'-methylthio)butylmalate * inchi-key: ** zizldvklmyvmnx-uh...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SO3 ==
+
== Metabolite CPDQT-37 ==
 
* smiles:
 
* smiles:
** [o-]s([o-])=o
+
** csccccc(c(o)c(=o)[o-])c(=o)[o-]
 
* common-name:
 
* common-name:
** sulfite
+
** 3-(4'-methylthio)butylmalate
 
* inchi-key:
 
* inchi-key:
** lsnnmfcwukxfee-uhfffaoysa-l
+
** zizldvklmyvmnx-uhfffaoysa-l
 
* molecular-weight:
 
* molecular-weight:
** 80.058
+
** 234.267
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-18206]]
 +
* [[RXNQT-4168]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[THIOSULFATE-SULFURTRANSFERASE-RXN]]
+
* [[RXN-18206]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=sulfite}}
+
{{#set: common-name=3-(4'-methylthio)butylmalate}}
{{#set: inchi-key=inchikey=lsnnmfcwukxfee-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=zizldvklmyvmnx-uhfffaoysa-l}}
{{#set: molecular-weight=80.058}}
+
{{#set: molecular-weight=234.267}}

Revision as of 18:45, 23 November 2020

Metabolite CPDQT-37

  • smiles:
    • csccccc(c(o)c(=o)[o-])c(=o)[o-]
  • common-name:
    • 3-(4'-methylthio)butylmalate
  • inchi-key:
    • zizldvklmyvmnx-uhfffaoysa-l
  • molecular-weight:
    • 234.267

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality