Difference between revisions of "VAL-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite B-KETOACYL-ACP == * common-name: ** a 3-oxoacyl-[acp] == Reaction(s) known to consume the compound == * 2.3.1.41-RXN * 3-OXOACYL-AC...") |
(Created page with "Category:metabolite == Metabolite IMIDAZOLE-ACETOL-P == * smiles: ** c1(nc=nc=1cc(cop([o-])(=o)[o-])=o) * common-name: ** imidazole acetol-phosphate * inchi-key: ** ycffms...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite IMIDAZOLE-ACETOL-P == |
| + | * smiles: | ||
| + | ** c1(nc=nc=1cc(cop([o-])(=o)[o-])=o) | ||
* common-name: | * common-name: | ||
| − | ** | + | ** imidazole acetol-phosphate |
| + | * inchi-key: | ||
| + | ** ycffmsolumramd-uhfffaoysa-l | ||
| + | * molecular-weight: | ||
| + | ** 218.105 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[HISTAMINOTRANS-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[IMIDPHOSDEHYD-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=imidazole acetol-phosphate}} |
| + | {{#set: inchi-key=inchikey=ycffmsolumramd-uhfffaoysa-l}} | ||
| + | {{#set: molecular-weight=218.105}} | ||
Revision as of 18:46, 23 November 2020
Contents
Metabolite IMIDAZOLE-ACETOL-P
- smiles:
- c1(nc=nc=1cc(cop([o-])(=o)[o-])=o)
- common-name:
- imidazole acetol-phosphate
- inchi-key:
- ycffmsolumramd-uhfffaoysa-l
- molecular-weight:
- 218.105
