Difference between revisions of "Protein-N5-alkylglutamines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2-OCTAPRENYL-6-HYDROXYPHENOL == * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c)c)c * common...") |
(Created page with "Category:metabolite == Metabolite XYLOSE == * smiles: ** c1(oc(o)c(o)c(o)c(o)1) * common-name: ** α-d-xylopyranose * inchi-key: ** srbfzhdqgsbbor-lechcgjusa-n * mole...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite XYLOSE == |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(oc(o)c(o)c(o)c(o)1) |
* common-name: | * common-name: | ||
| − | ** | + | ** α-d-xylopyranose |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** srbfzhdqgsbbor-lechcgjusa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 150.131 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-12402]] | ||
| + | * [[RXN0-5001]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=α-d-xylopyranose}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=srbfzhdqgsbbor-lechcgjusa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=150.131}} |
Revision as of 18:46, 23 November 2020
Contents
Metabolite XYLOSE
- smiles:
- c1(oc(o)c(o)c(o)c(o)1)
- common-name:
- α-d-xylopyranose
- inchi-key:
- srbfzhdqgsbbor-lechcgjusa-n
- molecular-weight:
- 150.131
