Difference between revisions of "Actinorhodin-Intermediate-2"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-4-DIHYDROXYBENZOATE == * smiles: ** c(c1(c=c(c(=cc=1)o)o))(=o)[o-] * common-name: ** protocatechuate * inchi-key: ** yquvcsbjeuqksh-uhf...") |
(Created page with "Category:metabolite == Metabolite CPD-8180 == * common-name: ** dna with lesion == Reaction(s) known to consume the compound == * RXN0-2621 == Reaction(s) known to pro...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-8180 == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** dna with lesion |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-2621]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dna with lesion}} |
| − | |||
| − | |||
Revision as of 18:46, 23 November 2020
Contents
Metabolite CPD-8180
- common-name:
- dna with lesion
