Difference between revisions of "ALLANTOIN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GUANOSINE-5DP-3DP == * smiles: ** c(op(=o)([o-])op(=o)(o)[o-])c1(oc(c(o)c(op([o-])(=o)op([o-])([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * c...")
 
(Created page with "Category:metabolite == Metabolite DIHYDROFOLATE == * smiles: ** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c3(cnc2(=c(c(=o)nc(n)=n2)n=3)) * common-name: ** 7,8-dihydr...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GUANOSINE-5DP-3DP ==
+
== Metabolite DIHYDROFOLATE ==
 
* smiles:
 
* smiles:
** c(op(=o)([o-])op(=o)(o)[o-])c1(oc(c(o)c(op([o-])(=o)op([o-])([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
+
** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c3(cnc2(=c(c(=o)nc(n)=n2)n=3))
 
* common-name:
 
* common-name:
** ppgpp
+
** 7,8-dihydrofolate monoglutamate
 
* inchi-key:
 
* inchi-key:
** bufllcufnheseh-uuokfmhzsa-i
+
** ozrnssudzolusn-lbprgkrzsa-l
 
* molecular-weight:
 
* molecular-weight:
** 598.123
+
** 441.402
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PPGPPSYN-RXN]]
+
* [[DHFOR2]]
 +
* [[DHFR]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GDPPYPHOSKIN-RXN]]
+
* [[DHFOR2]]
* [[PPPGPPHYDRO-RXN]]
+
* [[DHFR]]
 +
* [[DIHYDROFOLATESYNTH-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ppgpp}}
+
{{#set: common-name=7,8-dihydrofolate monoglutamate}}
{{#set: inchi-key=inchikey=bufllcufnheseh-uuokfmhzsa-i}}
+
{{#set: inchi-key=inchikey=ozrnssudzolusn-lbprgkrzsa-l}}
{{#set: molecular-weight=598.123}}
+
{{#set: molecular-weight=441.402}}

Revision as of 18:47, 23 November 2020

Metabolite DIHYDROFOLATE

  • smiles:
    • c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c3(cnc2(=c(c(=o)nc(n)=n2)n=3))
  • common-name:
    • 7,8-dihydrofolate monoglutamate
  • inchi-key:
    • ozrnssudzolusn-lbprgkrzsa-l
  • molecular-weight:
    • 441.402

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality