Difference between revisions of "TRP-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ALPHA-GLUCOSE-16-BISPHOSPHATE == * smiles: ** c(op([o-])(=o)[o-])c1(oc(c(c(c1o)o)o)op(=o)([o-])[o-]) * common-name: ** α-glucose 1,...") |
(Created page with "Category:metabolite == Metabolite DIHYDROFOLATE-GLU-N == * common-name: ** a 7,8-dihydrofolate == Reaction(s) known to consume the compound == * [[DIHYDROFOLATEREDUCT-RXN]...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DIHYDROFOLATE-GLU-N == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** a 7,8-dihydrofolate |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[DIHYDROFOLATEREDUCT-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[THYMIDYLATESYN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 7,8-dihydrofolate}} |
| − | |||
| − | |||
Revision as of 18:47, 23 November 2020
Contents
Metabolite DIHYDROFOLATE-GLU-N
- common-name:
- a 7,8-dihydrofolate
