Difference between revisions of "ALA-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDROFOLATE-GLU-N == * common-name: ** a 7,8-dihydrofolate == Reaction(s) known to consume the compound == * [[DIHYDROFOLATEREDUCT-RXN]...") |
(Created page with "Category:metabolite == Metabolite ARG == * smiles: ** c(nc(n)=[n+])ccc([n+])c(=o)[o-] * common-name: ** l-arginine * inchi-key: ** odksfydxxfifqn-bypyzucnsa-o * molecular-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ARG == |
| + | * smiles: | ||
| + | ** c(nc(n)=[n+])ccc([n+])c(=o)[o-] | ||
* common-name: | * common-name: | ||
| − | ** | + | ** l-arginine |
| + | * inchi-key: | ||
| + | ** odksfydxxfifqn-bypyzucnsa-o | ||
| + | * molecular-weight: | ||
| + | ** 175.21 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ARGDECARBOX-RXN]] |
| + | * [[ARGINASE-RXN]] | ||
| + | * [[ARGININE--TRNA-LIGASE-RXN]] | ||
| + | * [[ARGSUCCINLYA-RXN]] | ||
| + | * [[ExchangeSeed-ARG]] | ||
| + | * [[RXN-8956]] | ||
| + | * [[TransportSeed-ARG]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ARGDECARBOX-RXN]] |
| + | * [[ARGINASE-RXN]] | ||
| + | * [[ARGSUCCINLYA-RXN]] | ||
| + | * [[ExchangeSeed-ARG]] | ||
| + | * [[RXN-8956]] | ||
| + | * [[TransportSeed-ARG]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-arginine}} |
| + | {{#set: inchi-key=inchikey=odksfydxxfifqn-bypyzucnsa-o}} | ||
| + | {{#set: molecular-weight=175.21}} | ||
Revision as of 18:47, 23 November 2020
Contents
Metabolite ARG
- smiles:
- c(nc(n)=[n+])ccc([n+])c(=o)[o-]
- common-name:
- l-arginine
- inchi-key:
- odksfydxxfifqn-bypyzucnsa-o
- molecular-weight:
- 175.21
Reaction(s) known to consume the compound
- ARGDECARBOX-RXN
- ARGINASE-RXN
- ARGININE--TRNA-LIGASE-RXN
- ARGSUCCINLYA-RXN
- ExchangeSeed-ARG
- RXN-8956
- TransportSeed-ARG
