Difference between revisions of "MYO-INOSITOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-380 == * smiles: ** c(=o)([o-])c(=o)cs(=o)(=o)[o-] * common-name: ** 3-sulfopyruvate * inchi-key: ** buthmsuebypmkj-uhfffaoysa-l * mo...") |
(Created page with "Category:metabolite == Metabolite CPD0-882 == * smiles: ** cc(c([o-])=o)oc2(c(o)c1(coc(o1)c(nc(c)=o)2)) * common-name: ** 1,6-anhydro-n-acetyl-β-muramate * inchi-key:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD0-882 == |
* smiles: | * smiles: | ||
| − | ** c | + | ** cc(c([o-])=o)oc2(c(o)c1(coc(o1)c(nc(c)=o)2)) |
* common-name: | * common-name: | ||
| − | ** | + | ** 1,6-anhydro-n-acetyl-β-muramate |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zfegyumhfzoyiy-mkfckldksa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 274.25 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN0-5226]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1,6-anhydro-n-acetyl-β-muramate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zfegyumhfzoyiy-mkfckldksa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=274.25}} |
Revision as of 18:47, 23 November 2020
Contents
Metabolite CPD0-882
- smiles:
- cc(c([o-])=o)oc2(c(o)c1(coc(o1)c(nc(c)=o)2))
- common-name:
- 1,6-anhydro-n-acetyl-β-muramate
- inchi-key:
- zfegyumhfzoyiy-mkfckldksa-m
- molecular-weight:
- 274.25
