Difference between revisions of "E-"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CYTIDINE == * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))o * common-name: ** cytidine * inchi-key: ** uhdgcwiwmrvcdj-xvfcmesisa-n...") |
(Created page with "Category:metabolite == Metabolite Single-Stranded-DNAs == * common-name: ** a single stranded dna == Reaction(s) known to consume the compound == * 3.1.11.6-RXN * RX...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Single-Stranded-DNAs == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** a single stranded dna |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[3.1.11.6-RXN]] |
| − | + | * [[RXN0-5021]] | |
| − | |||
| − | |||
| − | |||
| − | * [[RXN0- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN0-4261]] |
| − | * [[ | + | * [[RXN0-5021]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a single stranded dna}} |
| − | |||
| − | |||
Revision as of 18:47, 23 November 2020
Contents
Metabolite Single-Stranded-DNAs
- common-name:
- a single stranded dna
