Difference between revisions of "MONOMER0-4342"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DNA-with-Uracils == * common-name: ** a uracil in dna == Reaction(s) known to consume the compound == * RXN0-2584 == Reaction(s) know...")
 
(Created page with "Category:metabolite == Metabolite MALTOTRIOSE == * smiles: ** c(c1(oc(c(c(c1o)o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co)))o * common-name: ** maltotriose * inchi-key:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DNA-with-Uracils ==
+
== Metabolite MALTOTRIOSE ==
 +
* smiles:
 +
** c(c1(oc(c(c(c1o)o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co)))o
 
* common-name:
 
* common-name:
** a uracil in dna
+
** maltotriose
 +
* inchi-key:
 +
** fygdtmlnykfzsv-dzoucchmsa-n
 +
* molecular-weight:
 +
** 504.441
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-2584]]
+
* [[AMYLOMALT-RXN]]
 +
* [[MALTET-RXN]]
 +
* [[RXN-12391]]
 +
* [[RXN0-5183]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[MALTET-RXN]]
 +
* [[RXN0-5182]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a uracil in dna}}
+
{{#set: common-name=maltotriose}}
 +
{{#set: inchi-key=inchikey=fygdtmlnykfzsv-dzoucchmsa-n}}
 +
{{#set: molecular-weight=504.441}}

Revision as of 18:48, 23 November 2020

Metabolite MALTOTRIOSE

  • smiles:
    • c(c1(oc(c(c(c1o)o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co)))o
  • common-name:
    • maltotriose
  • inchi-key:
    • fygdtmlnykfzsv-dzoucchmsa-n
  • molecular-weight:
    • 504.441

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality