Difference between revisions of "Proteins-L-Threonines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 4-AMINO-4-DEOXYCHORISMATE == * smiles: ** c=c(c(=o)[o-])oc1(c([n+])c=cc(c([o-])=o)=c1) * common-name: ** 4-amino-4-deoxychorismate * inch...") |
(Created page with "Category:metabolite == Metabolite AGMATHINE == * smiles: ** c(ccc[n+])nc(=[n+])n * common-name: ** agmatine * inchi-key: ** qyppjabkjhavhs-uhfffaoysa-p * molecular-weight:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite AGMATHINE == |
* smiles: | * smiles: | ||
| − | ** | + | ** c(ccc[n+])nc(=[n+])n |
* common-name: | * common-name: | ||
| − | ** | + | ** agmatine |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** qyppjabkjhavhs-uhfffaoysa-p |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 132.208 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[AGMATIN-RXN]] |
| + | * [[ARGDECARBOX-RXN]] | ||
| + | * [[RXN-12514]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ARGDECARBOX-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=agmatine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qyppjabkjhavhs-uhfffaoysa-p}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=132.208}} |
Revision as of 18:48, 23 November 2020
Contents
Metabolite AGMATHINE
- smiles:
- c(ccc[n+])nc(=[n+])n
- common-name:
- agmatine
- inchi-key:
- qyppjabkjhavhs-uhfffaoysa-p
- molecular-weight:
- 132.208
