Difference between revisions of "Alpha-Amyloses"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9406 == * smiles: ** ccc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o...")
 
(Created page with "Category:metabolite == Metabolite Protein-phospho-L-histidines == * common-name: ** a [protein]-n-phospho-l-histidine == Reaction(s) known to consume the compound == * R...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9406 ==
+
== Metabolite Protein-phospho-L-histidines ==
* smiles:
 
** ccc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c([o-])=o
 
 
* common-name:
 
* common-name:
** (2s)-ethylmalonyl-coa
+
** a [protein]-n-phospho-l-histidine
* inchi-key:
 
** vugzqvcbbbezqe-uqcjfraesa-i
 
* molecular-weight:
 
** 876.595
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17133]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8957]]
+
* [[2.7.13.3-RXN]]
 +
* [[RXN-17133]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2s)-ethylmalonyl-coa}}
+
{{#set: common-name=a [protein]-n-phospho-l-histidine}}
{{#set: inchi-key=inchikey=vugzqvcbbbezqe-uqcjfraesa-i}}
 
{{#set: molecular-weight=876.595}}
 

Revision as of 18:48, 23 November 2020

Metabolite Protein-phospho-L-histidines

  • common-name:
    • a [protein]-n-phospho-l-histidine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-n-phospho-l-histidine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.