Difference between revisions of "N-ACETYL-D-GALACTOSAMINE-6-PHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18379 == * smiles: ** cccccccccccccc(=o)occ(o)cop(=o)([o-])[o-] * common-name: ** 1-myristoylglycerol 3-phosphate * inchi-key: ** faz...") |
(Created page with "Category:metabolite == Metabolite N-ACETYL-D-GALACTOSAMINE-6-PHOSPHATE == * smiles: ** cc(=o)nc1(c(o)oc(cop(=o)([o-])[o-])c(o)c(o)1) * common-name: ** n-acetyl-d-galactosa...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N-ACETYL-D-GALACTOSAMINE-6-PHOSPHATE == |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=o)nc1(c(o)oc(cop(=o)([o-])[o-])c(o)c(o)1) |
* common-name: | * common-name: | ||
| − | ** | + | ** n-acetyl-d-galactosamine 6-phosphate |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** brgmhayqazfzdj-kewyirbnsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 299.174 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[AGDC2]] |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-acetyl-d-galactosamine 6-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=brgmhayqazfzdj-kewyirbnsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=299.174}} |
Latest revision as of 17:44, 15 January 2021
Contents
Metabolite N-ACETYL-D-GALACTOSAMINE-6-PHOSPHATE
- smiles:
- cc(=o)nc1(c(o)oc(cop(=o)([o-])[o-])c(o)c(o)1)
- common-name:
- n-acetyl-d-galactosamine 6-phosphate
- inchi-key:
- brgmhayqazfzdj-kewyirbnsa-l
- molecular-weight:
- 299.174
