Difference between revisions of "OXIDIZED-GLUTATHIONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite cis-delta19-3-hydroxyC38-ACPs == * common-name: ** a cis-delta19-3-hydroxyc38:1-[acp] == Reaction(s) known to consume the compound == ==...") |
(Created page with "Category:metabolite == Metabolite OXIDIZED-GLUTATHIONE == * smiles: ** c(sscc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o * commo...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite OXIDIZED-GLUTATHIONE == |
| + | * smiles: | ||
| + | ** c(sscc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o | ||
* common-name: | * common-name: | ||
| − | ** | + | ** glutathione disulfide |
| + | * inchi-key: | ||
| + | ** ypzrwbkmtbyptk-bjdjzhngsa-l | ||
| + | * molecular-weight: | ||
| + | ** 610.61 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[GLUTATHIONE-REDUCT-NADPH-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[GLUTATHIONE-PEROXIDASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=glutathione disulfide}} |
| + | {{#set: inchi-key=inchikey=ypzrwbkmtbyptk-bjdjzhngsa-l}} | ||
| + | {{#set: molecular-weight=610.61}} | ||
Latest revision as of 17:45, 15 January 2021
Contents
Metabolite OXIDIZED-GLUTATHIONE
- smiles:
- c(sscc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
- common-name:
- glutathione disulfide
- inchi-key:
- ypzrwbkmtbyptk-bjdjzhngsa-l
- molecular-weight:
- 610.61
