Difference between revisions of "OCTAPRENYL-METHOXY-BENZOQUINONE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MANNKIN-RXN-CPD-12601/ATP//MANNOSE-6P/ADP/PROTON.37. MANNKIN-RXN-CPD-12601/ATP//MANNOSE-6P/ADP/PROT...") |
(Created page with "Category:metabolite == Metabolite CPD-787 == * common-name: ** (2z,4z)-2-hydroxyhepta-2,4-dienedioate * smiles: ** c([o-])(=o)cc=cc=c(o)c(=o)[o-] * inchi-key: ** zbcbetmbs...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-787 == |
− | * | + | * common-name: |
− | ** | + | ** (2z,4z)-2-hydroxyhepta-2,4-dienedioate |
− | == Reaction | + | * smiles: |
− | * | + | ** c([o-])(=o)cc=cc=c(o)c(=o)[o-] |
− | == | + | * inchi-key: |
− | == | + | ** zbcbetmbsdtinl-nwjcxacmsa-l |
− | + | * molecular-weight: | |
− | + | ** 170.121 | |
− | + | == Reaction(s) known to consume the compound == | |
− | {{#set: | + | * [[RXN1K-87]] |
− | {{#set: | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | {{#set: | + | {{#set: common-name=(2z,4z)-2-hydroxyhepta-2,4-dienedioate}} |
− | + | {{#set: inchi-key=inchikey=zbcbetmbsdtinl-nwjcxacmsa-l}} | |
− | + | {{#set: molecular-weight=170.121}} | |
− |
Revision as of 20:37, 18 December 2020
Contents
Metabolite CPD-787
- common-name:
- (2z,4z)-2-hydroxyhepta-2,4-dienedioate
- smiles:
- c([o-])(=o)cc=cc=c(o)c(=o)[o-]
- inchi-key:
- zbcbetmbsdtinl-nwjcxacmsa-l
- molecular-weight:
- 170.121