Difference between revisions of "1-KETO-2-METHYLVALERATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite INDOLE-3-GLYCOL == * common-name: ** indole-3-glycol * smiles: ** c2(=c(c1(c=cc=cc=1n2))c(o)co) * inchi-key: ** xnjdzrgywqbbmz-uhfffaoysa...")
(Created page with "Category:metabolite == Metabolite 1-KETO-2-METHYLVALERATE == * common-name: ** (r)-2,3-dihydroxy-3-methylpentanoate * smiles: ** ccc(o)(c)c(c([o-])=o)o * inchi-key: ** pdg...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite INDOLE-3-GLYCOL ==
+
== Metabolite 1-KETO-2-METHYLVALERATE ==
 
* common-name:
 
* common-name:
** indole-3-glycol
+
** (r)-2,3-dihydroxy-3-methylpentanoate
 
* smiles:
 
* smiles:
** c2(=c(c1(c=cc=cc=1n2))c(o)co)
+
** ccc(o)(c)c(c([o-])=o)o
 
* inchi-key:
 
* inchi-key:
** xnjdzrgywqbbmz-uhfffaoysa-n
+
** pdgxjdxvgmhuir-ujursfkzsa-m
 
* molecular-weight:
 
* molecular-weight:
** 177.202
+
** 147.15
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[DIHYDROXYMETVALDEHYDRAT-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-5424]]
+
* [[ACETOOHBUTREDUCTOISOM-RXN]]
 +
* [[KARI_LPAREN_23dhmp_RPAREN_]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=indole-3-glycol}}
+
{{#set: common-name=(r)-2,3-dihydroxy-3-methylpentanoate}}
{{#set: inchi-key=inchikey=xnjdzrgywqbbmz-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=pdgxjdxvgmhuir-ujursfkzsa-m}}
{{#set: molecular-weight=177.202}}
+
{{#set: molecular-weight=147.15}}

Latest revision as of 11:16, 18 March 2021

Metabolite 1-KETO-2-METHYLVALERATE

  • common-name:
    • (r)-2,3-dihydroxy-3-methylpentanoate
  • smiles:
    • ccc(o)(c)c(c([o-])=o)o
  • inchi-key:
    • pdgxjdxvgmhuir-ujursfkzsa-m
  • molecular-weight:
    • 147.15

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality