Difference between revisions of "2-KETO-3-METHYL-VALERATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-L-GLUTAMYL-PEPTIDE == * common-name: ** a 5-l-glutamyl-[peptide] == Reaction(s) known to consume the compound == * GAMMA-GLUTAMYLTRAN...")
(Created page with "Category:metabolite == Metabolite CPD-17545 == * common-name: ** 3-({[(2r,3r)-3-carbamoyloxiran-2-yl]carbonyl}amino)-l-alanine * smiles: ** c([n+])c(c([o-])=o)nc(=o)c1(oc(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-L-GLUTAMYL-PEPTIDE ==
+
== Metabolite CPD-17545 ==
 
* common-name:
 
* common-name:
** a 5-l-glutamyl-[peptide]
+
** 3-({[(2r,3r)-3-carbamoyloxiran-2-yl]carbonyl}amino)-l-alanine
 +
* smiles:
 +
** c([n+])c(c([o-])=o)nc(=o)c1(oc(c(=o)n)1)
 +
* inchi-key:
 +
** neroffugairxgm-wxjvfsnfsa-n
 +
* molecular-weight:
 +
** 217.181
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GAMMA-GLUTAMYLTRANSFERASE-RXN]]
+
* [[RXN-16294]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-16294]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 5-l-glutamyl-[peptide]}}
+
{{#set: common-name=3-({[(2r,3r)-3-carbamoyloxiran-2-yl]carbonyl}amino)-l-alanine}}
 +
{{#set: inchi-key=inchikey=neroffugairxgm-wxjvfsnfsa-n}}
 +
{{#set: molecular-weight=217.181}}

Revision as of 08:26, 15 March 2021

Metabolite CPD-17545

  • common-name:
    • 3-({[(2r,3r)-3-carbamoyloxiran-2-yl]carbonyl}amino)-l-alanine
  • smiles:
    • c([n+])c(c([o-])=o)nc(=o)c1(oc(c(=o)n)1)
  • inchi-key:
    • neroffugairxgm-wxjvfsnfsa-n
  • molecular-weight:
    • 217.181

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "3-({[(2r,3r)-3-carbamoyloxiran-2-yl]carbonyl}amino)-l-alanine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.