Difference between revisions of "2-KETO-3-METHYL-VALERATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Ribonucleoside-Diphosphates == * common-name: ** a ribonucleoside diphosphate == Reaction(s) known to consume the compound == * RIBONUC...")
(Created page with "Category:metabolite == Metabolite CPD-13394 == * common-name: ** glycyl-l-glutamine * smiles: ** c([n+])c(=o)nc(c([o-])=o)ccc(=o)n * inchi-key: ** pnmuaggsdzxthx-bypyzucns...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Ribonucleoside-Diphosphates ==
+
== Metabolite CPD-13394 ==
 
* common-name:
 
* common-name:
** a ribonucleoside diphosphate
+
** glycyl-l-glutamine
 +
* smiles:
 +
** c([n+])c(=o)nc(c([o-])=o)ccc(=o)n
 +
* inchi-key:
 +
** pnmuaggsdzxthx-bypyzucnsa-n
 +
* molecular-weight:
 +
** 203.197
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RIBONUCLEOSIDE-DIP-REDUCTI-RXN]]
+
* [[RXN0-6983]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a ribonucleoside diphosphate}}
+
{{#set: common-name=glycyl-l-glutamine}}
 +
{{#set: inchi-key=inchikey=pnmuaggsdzxthx-bypyzucnsa-n}}
 +
{{#set: molecular-weight=203.197}}

Revision as of 18:55, 14 January 2021

Metabolite CPD-13394

  • common-name:
    • glycyl-l-glutamine
  • smiles:
    • c([n+])c(=o)nc(c([o-])=o)ccc(=o)n
  • inchi-key:
    • pnmuaggsdzxthx-bypyzucnsa-n
  • molecular-weight:
    • 203.197

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality