Difference between revisions of "23-DIPHOSPHOGLYCERATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ06513 == * transcription-direction: ** positive * right-end-position: ** 63788 * left-end-position: ** 53596 * centisome-position: ** 68.32303...") |
(Created page with "Category:metabolite == Metabolite 23-DIPHOSPHOGLYCERATE == * common-name: ** 2,3-diphospho-d-glycerate * smiles: ** c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-] * inchi...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite 23-DIPHOSPHOGLYCERATE == |
− | * | + | * common-name: |
− | ** | + | ** 2,3-diphospho-d-glycerate |
− | * | + | * smiles: |
− | ** | + | ** c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-] |
− | * | + | * inchi-key: |
− | ** | + | ** xohueycvluuejj-uwtatzphsa-i |
− | * | + | * molecular-weight: |
− | ** | + | ** 260.998 |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[RXN-15509]] | |
− | == Reaction(s) | + | * [[RXN-15510]] |
− | * [[ | + | * [[RXN-15511]] |
− | * | + | * [[RXN-15512]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | * | + | * [[BISPHOSPHOGLYCERATE-MUTASE-RXN]] |
− | + | * [[RXN-15509]] | |
− | * [[ | + | * [[RXN-15510]] |
− | * | + | * [[RXN-15511]] |
− | * | + | * [[RXN-15512]] |
− | * [[RXN- | + | * [[RXN-17276]] |
− | * | + | == Reaction(s) of unknown directionality == |
− | * | + | {{#set: common-name=2,3-diphospho-d-glycerate}} |
− | == | + | {{#set: inchi-key=inchikey=xohueycvluuejj-uwtatzphsa-i}} |
− | + | {{#set: molecular-weight=260.998}} | |
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite 23-DIPHOSPHOGLYCERATE
- common-name:
- 2,3-diphospho-d-glycerate
- smiles:
- c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-]
- inchi-key:
- xohueycvluuejj-uwtatzphsa-i
- molecular-weight:
- 260.998