Difference between revisions of "23-DIPHOSPHOGLYCERATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ06513 == * transcription-direction: ** positive * right-end-position: ** 63788 * left-end-position: ** 53596 * centisome-position: ** 68.32303...")
(Created page with "Category:metabolite == Metabolite 23-DIPHOSPHOGLYCERATE == * common-name: ** 2,3-diphospho-d-glycerate * smiles: ** c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-] * inchi...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ06513 ==
+
== Metabolite 23-DIPHOSPHOGLYCERATE ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 2,3-diphospho-d-glycerate
−
* right-end-position:
+
* smiles:
−
** 63788
+
** c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-]
−
* left-end-position:
+
* inchi-key:
−
** 53596
+
** xohueycvluuejj-uwtatzphsa-i
−
* centisome-position:
+
* molecular-weight:
−
** 68.32303   
+
** 260.998
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-15509]]
−
== Reaction(s) associated ==
+
* [[RXN-15510]]
−
* [[3.2.1.8-RXN]]
+
* [[RXN-15511]]
−
** Category: [[annotation]]
+
* [[RXN-15512]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
** Category: [[orthology]]
+
* [[BISPHOSPHOGLYCERATE-MUTASE-RXN]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-15509]]
−
* [[3.2.1.91-RXN]]
+
* [[RXN-15510]]
−
** Category: [[annotation]]
+
* [[RXN-15511]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-15512]]
−
* [[RXN-12305]]
+
* [[RXN-17276]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=2,3-diphospho-d-glycerate}}
−
== Pathway(s) associated ==
+
{{#set: inchi-key=inchikey=xohueycvluuejj-uwtatzphsa-i}}
−
* [[PWY-6784]]
+
{{#set: molecular-weight=260.998}}
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-6788]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=63788}}
 
−
{{#set: left-end-position=53596}}
 
−
{{#set: centisome-position=68.32303    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=3}}
 
−
{{#set: nb pathway associated=2}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite 23-DIPHOSPHOGLYCERATE

  • common-name:
    • 2,3-diphospho-d-glycerate
  • smiles:
    • c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-]
  • inchi-key:
    • xohueycvluuejj-uwtatzphsa-i
  • molecular-weight:
    • 260.998

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=23-DIPHOSPHOGLYCERATE&oldid=137056"