Difference between revisions of "23-DIPHOSPHOGLYCERATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ19152 == * transcription-direction: ** positive * right-end-position: ** 207013 * left-end-position: ** 193812 * centisome-position: ** 30.291975...")
(Created page with "Category:metabolite == Metabolite 23-DIPHOSPHOGLYCERATE == * common-name: ** 2,3-diphospho-d-glycerate * smiles: ** c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-] * inchi...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ19152 ==
+
== Metabolite 23-DIPHOSPHOGLYCERATE ==
* transcription-direction:
+
* common-name:
** positive
+
** 2,3-diphospho-d-glycerate
* right-end-position:
+
* smiles:
** 207013
+
** c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-]
* left-end-position:
+
* inchi-key:
** 193812
+
** xohueycvluuejj-uwtatzphsa-i
* centisome-position:
+
* molecular-weight:
** 30.291975   
+
** 260.998
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-15509]]
== Reaction(s) associated ==
+
* [[RXN-15510]]
* [[RXN-15559]]
+
* [[RXN-15511]]
** Category: [[annotation]]
+
* [[RXN-15512]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
* [[RXN-15560]]
+
* [[BISPHOSPHOGLYCERATE-MUTASE-RXN]]
** Category: [[annotation]]
+
* [[RXN-15509]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-15510]]
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
+
* [[RXN-15511]]
** Category: [[annotation]]
+
* [[RXN-15512]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-17276]]
== Pathway(s) associated ==
+
== Reaction(s) of unknown directionality ==
* [[PWY-7511]]
+
{{#set: common-name=2,3-diphospho-d-glycerate}}
** '''7''' reactions found over '''9''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=xohueycvluuejj-uwtatzphsa-i}}
{{#set: transcription-direction=positive}}
+
{{#set: molecular-weight=260.998}}
{{#set: right-end-position=207013}}
 
{{#set: left-end-position=193812}}
 
{{#set: centisome-position=30.291975    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=3}}
 
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite 23-DIPHOSPHOGLYCERATE

  • common-name:
    • 2,3-diphospho-d-glycerate
  • smiles:
    • c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-]
  • inchi-key:
    • xohueycvluuejj-uwtatzphsa-i
  • molecular-weight:
    • 260.998

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality