Difference between revisions of "23-DIPHOSPHOGLYCERATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13717 == * common-name: ** l-selenocystathionine * smiles: ** c([se]cc(c([o-])=o)[n+])cc([n+])c(=o)[o-] * inchi-key: ** znwydqpouqrdl...")
(Created page with "Category:metabolite == Metabolite Chalcones == * common-name: ** a chalcone == Reaction(s) known to consume the compound == * CHALCONE-ISOMERASE-RXN == Reaction(s) kno...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13717 ==
+
== Metabolite Chalcones ==
 
* common-name:
 
* common-name:
** l-selenocystathionine
+
** a chalcone
* smiles:
 
** c([se]cc(c([o-])=o)[n+])cc([n+])c(=o)[o-]
 
* inchi-key:
 
** znwydqpouqrdly-whfbiakzsa-n
 
* molecular-weight:
 
** 269.159
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12729]]
+
* [[CHALCONE-ISOMERASE-RXN]]
* [[RXN-15137]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACHMSSELCYSL]]
+
* [[CHALCONE-ISOMERASE-RXN]]
* [[ACHMSSELCYSLh]]
 
* [[RXN-12728]]
 
* [[SUCHMSSELCYSL]]
 
* [[SUCHMSSELCYSLh]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-selenocystathionine}}
+
{{#set: common-name=a chalcone}}
{{#set: inchi-key=inchikey=znwydqpouqrdly-whfbiakzsa-n}}
 
{{#set: molecular-weight=269.159}}
 

Revision as of 13:08, 14 January 2021

Metabolite Chalcones

  • common-name:
    • a chalcone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality